{
  "id": 2818,
  "name": "vidarabine",
  "cas_reg_no": "5536-17-4",
  "smiles": "NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O",
  "inchikey": "OIRDTQYFTABQOQ-UHTZMRCNSA-N",
  "inchi": "InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7+,10-/m1/s1",
  "formula": "C10H13N5O4",
  "molweight": 267.245,
  "xrefs": [
    {
      "xref_type": "VUID",
      "xref": "4018650"
    },
    {
      "xref_type": "NUI",
      "xref": "N0000146963"
    },
    {
      "xref_type": "KEGG_DRUG",
      "xref": "D00406"
    },
    {
      "xref_type": "SECONDARY_CAS_RN",
      "xref": "24356-66-9"
    },
    {
      "xref_type": "VANDF",
      "xref": "4018650"
    },
    {
      "xref_type": "UMLSCUI",
      "xref": "C0042646"
    },
    {
      "xref_type": "CHEBI",
      "xref": "CHEBI:45327"
    },
    {
      "xref_type": "PDB_CHEM_ID",
      "xref": "RAB"
    },
    {
      "xref_type": "ChEMBL_ID",
      "xref": "CHEMBL1090"
    },
    {
      "xref_type": "PUBCHEM_CID",
      "xref": "21704"
    },
    {
      "xref_type": "MESH_DESCRIPTOR_UI",
      "xref": "D014740"
    },
    {
      "xref_type": "INN_ID",
      "xref": "2842"
    },
    {
      "xref_type": "UNII",
      "xref": "FA2DM6879K"
    },
    {
      "xref_type": "IUPHAR_LIGAND_ID",
      "xref": "4806"
    },
    {
      "xref_type": "DRUGBANK_ID",
      "xref": "DB00194"
    },
    {
      "xref_type": "RXNORM",
      "xref": "11194"
    },
    {
      "xref_type": "MMSL",
      "xref": "5673"
    },
    {
      "xref_type": "NDDF",
      "xref": "003014"
    },
    {
      "xref_type": "SNOMEDCT_US",
      "xref": "37306000"
    },
    {
      "xref_type": "SNOMEDCT_US",
      "xref": "373759007"
    }
  ],
  "synonyms": [
    "adenine arabinoside",
    "araadenosine",
    "arabinosyladenine",
    "vidarabin",
    "vidarabine",
    "vidarabine anhydrous"
  ],
  "atcs": [
    {
      "atc_code": "D09AA11",
      "atc_l1_code": "D",
      "atc_l1_name": "DERMATOLOGICALS",
      "atc_l2_code": "D09",
      "atc_l2_name": "MEDICATED DRESSINGS",
      "atc_l3_code": "D09A",
      "atc_l3_name": "MEDICATED DRESSINGS",
      "atc_l4_code": "D09AA",
      "atc_l4_name": "Medicated dressings with antiinfectives",
      "atc_substance": "benzalkonium"
    },
    {
      "atc_code": "M03AC01",
      "atc_l1_code": "M",
      "atc_l1_name": "MUSCULO-SKELETAL SYSTEM",
      "atc_l2_code": "M03",
      "atc_l2_name": "MUSCLE RELAXANTS",
      "atc_l3_code": "M03A",
      "atc_l3_name": "MUSCLE RELAXANTS, PERIPHERALLY ACTING AGENTS",
      "atc_l4_code": "M03AC",
      "atc_l4_name": "Other quaternary ammonium compounds",
      "atc_substance": "pancuronium"
    }
  ],
  "targets": [
    {
      "target_id": 70,
      "target_name": "DNA polymerase catalytic subunit",
      "gene": null,
      "action_type": "INHIBITOR",
      "act_source": "CHEMBL",
      "act_type": null,
      "act_comment": "Mechanism of Action; CHEMBL1872; SINGLE PROTEIN",
      "relation": null,
      "moa": 1.0,
      "moa_source": "CHEMBL",
      "moa_source_url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1090",
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 300,
      "target_name": "Deoxycytidine kinase",
      "gene": "DCK",
      "action_type": null,
      "act_source": "WOMBAT-PK",
      "act_type": null,
      "act_comment": null,
      "relation": null,
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 322,
      "target_name": "DNA polymerase alpha catalytic subunit",
      "gene": "POLA1",
      "action_type": null,
      "act_source": "WOMBAT-PK",
      "act_type": null,
      "act_comment": null,
      "relation": null,
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 323,
      "target_name": "Ribonucleoside-diphosphate reductase large subunit",
      "gene": "RRM1",
      "action_type": null,
      "act_source": "WOMBAT-PK",
      "act_type": null,
      "act_comment": null,
      "relation": null,
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 324,
      "target_name": "Ribonucleoside-diphosphate reductase subunit M2",
      "gene": "RRM2",
      "action_type": null,
      "act_source": "WOMBAT-PK",
      "act_type": null,
      "act_comment": null,
      "relation": null,
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 359,
      "target_name": "Deoxyguanosine kinase, mitochondrial",
      "gene": "DGUOK",
      "action_type": null,
      "act_source": "WOMBAT-PK",
      "act_type": null,
      "act_comment": null,
      "relation": null,
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 360,
      "target_name": "Ribose-phosphate pyrophosphokinase 1",
      "gene": "PRPS1",
      "action_type": null,
      "act_source": "WOMBAT-PK",
      "act_type": null,
      "act_comment": null,
      "relation": null,
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 550,
      "target_name": "Dipeptidyl peptidase 4",
      "gene": "DPP4",
      "action_type": null,
      "act_source": "CHEMBL",
      "act_type": "IC50",
      "act_comment": "Inhibition of human DPP4 from human Caco-2 cells",
      "relation": "=",
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 3434,
      "target_name": "Adenylate cyclase type V",
      "gene": "Adcy5",
      "action_type": null,
      "act_source": "CHEMBL",
      "act_type": "IC50",
      "act_comment": "Compound was evaluated for inhibition of adenylate cyclase from rat brain",
      "relation": "=",
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 3560,
      "target_name": "Adenosylhomocysteinase ",
      "gene": "Ahcy",
      "action_type": null,
      "act_source": "CHEMBL",
      "act_type": "Ki",
      "act_comment": "Activity determined in mouse liver S-adenosyl-L-homocysteine hydrolase and expressed as KI values.",
      "relation": "=",
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    }
  ],
  "indications": [
    {
      "omop_concept_id": 21000179,
      "omop_concept_name": "Herpes simplex dendritic keratitis",
      "umls_cui": "C0022570",
      "umls_semantic_type": "T047",
      "snomed_conceptid": 29943008,
      "snomed_full_name": "Herpes simplex dendritic keratitis"
    },
    {
      "omop_concept_id": 21000180,
      "omop_concept_name": "Herpes simplex keratitis",
      "umls_cui": "C0019357",
      "umls_semantic_type": "T047",
      "snomed_conceptid": 9389005,
      "snomed_full_name": "Herpes simplex keratitis"
    }
  ]
}