{
  "id": 1993,
  "name": "opipramol",
  "cas_reg_no": "315-72-0",
  "smiles": "OCCN1CCN(CCCN2C3=CC=CC=C3C=CC3=C2C=CC=C3)CC1",
  "inchikey": "YNZFUWZUGRBMHL-UHFFFAOYSA-N",
  "inchi": "InChI=1S/C23H29N3O/c27-19-18-25-16-14-24(15-17-25)12-5-13-26-22-8-3-1-6-20(22)10-11-21-7-2-4-9-23(21)26/h1-4,6-11,27H,5,12-19H2",
  "formula": "C23H29N3O",
  "molweight": 363.505,
  "xrefs": [
    {
      "xref_type": "NUI",
      "xref": "N0000167254"
    },
    {
      "xref_type": "KEGG_DRUG",
      "xref": "D08297"
    },
    {
      "xref_type": "UMLSCUI",
      "xref": "C0029105"
    },
    {
      "xref_type": "CHEBI",
      "xref": "CHEBI:94614"
    },
    {
      "xref_type": "ChEMBL_ID",
      "xref": "CHEMBL370753"
    },
    {
      "xref_type": "MESH_DESCRIPTOR_UI",
      "xref": "D009888"
    },
    {
      "xref_type": "DRUGBANK_ID",
      "xref": "DB12930"
    },
    {
      "xref_type": "IUPHAR_LIGAND_ID",
      "xref": "11247"
    },
    {
      "xref_type": "INN_ID",
      "xref": "1838"
    },
    {
      "xref_type": "UNII",
      "xref": "D23ZXO613C"
    },
    {
      "xref_type": "PUBCHEM_CID",
      "xref": "9417"
    },
    {
      "xref_type": "RXNORM",
      "xref": "7674"
    },
    {
      "xref_type": "NDDF",
      "xref": "004149"
    }
  ],
  "synonyms": [
    "opipramol",
    "opipramol dihydrochloride",
    "opramidol"
  ],
  "atcs": [
    {
      "atc_code": "J07BG01",
      "atc_l1_code": "J",
      "atc_l1_name": "ANTIINFECTIVES FOR SYSTEMIC USE",
      "atc_l2_code": "J07",
      "atc_l2_name": "VACCINES",
      "atc_l3_code": "J07B",
      "atc_l3_name": "VIRAL VACCINES",
      "atc_l4_code": "J07BG",
      "atc_l4_name": "Rabies vaccines",
      "atc_substance": "rabies, inactivated, whole virus"
    }
  ],
  "targets": [
    {
      "target_id": 91,
      "target_name": "Sigma non-opioid intracellular receptor 1",
      "gene": "SIGMAR1",
      "action_type": null,
      "act_source": "CHEMBL",
      "act_type": "Ki",
      "act_comment": "Affinity for sigma receptor type 1 of guinea pig using [3H]ifenprodil or (+)-[3H]pentazocine radioligand",
      "relation": "=",
      "moa": null,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 96,
      "target_name": "3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase",
      "gene": "EBP",
      "action_type": null,
      "act_source": "CHEMBL",
      "act_type": "Ki",
      "act_comment": "Affinity for human EMP expressed in ERG2 deficient strain of Saccharomyces cerevisiae using [3H]ifenprodil or (+)-[3H]pentazocine as radioligand",
      "relation": "=",
      "moa": null,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 2014,
      "target_name": "C-8 sterol isomerase",
      "gene": "ERG2",
      "action_type": null,
      "act_source": "CHEMBL",
      "act_type": "Ki",
      "act_comment": "Affinity for ERG2 of Saccharomyces cerevisiae using [3H]ifenprodil or (+)-[3H]pentazocine radioligand",
      "relation": "=",
      "moa": null,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    }
  ],
  "indications": [
    {
      "omop_concept_id": 21001022,
      "omop_concept_name": "Depressive disorder",
      "umls_cui": "C0011581",
      "umls_semantic_type": "T048",
      "snomed_conceptid": 35489007,
      "snomed_full_name": "Depressive disorder"
    }
  ]
}