{
  "id": 867,
  "name": "dicoumarol",
  "cas_reg_no": "66-76-2",
  "smiles": "OC1=C(CC2=C(O)C3=C(OC2=O)C=CC=C3)C(=O)OC2=CC=CC=C12",
  "inchikey": "DOBMPNYZJYQDGZ-UHFFFAOYSA-N",
  "inchi": "InChI=1S/C19H12O6/c20-16-10-5-1-3-7-14(10)24-18(22)12(16)9-13-17(21)11-6-2-4-8-15(11)25-19(13)23/h1-8,20-21H,9H2",
  "formula": "C19H12O6",
  "molweight": 336.299,
  "xrefs": [
    {
      "xref_type": "VUID",
      "xref": "4018715"
    },
    {
      "xref_type": "NUI",
      "xref": "N0000147021"
    },
    {
      "xref_type": "KEGG_DRUG",
      "xref": "D03798"
    },
    {
      "xref_type": "VANDF",
      "xref": "4018715"
    },
    {
      "xref_type": "UMLSCUI",
      "xref": "C0733631"
    },
    {
      "xref_type": "CHEBI",
      "xref": "CHEBI:4513"
    },
    {
      "xref_type": "PDB_CHEM_ID",
      "xref": "DTC"
    },
    {
      "xref_type": "ChEMBL_ID",
      "xref": "CHEMBL1466"
    },
    {
      "xref_type": "DRUGBANK_ID",
      "xref": "DB00266"
    },
    {
      "xref_type": "MESH_DESCRIPTOR_UI",
      "xref": "D001728"
    },
    {
      "xref_type": "PUBCHEM_CID",
      "xref": "54676038"
    },
    {
      "xref_type": "IUPHAR_LIGAND_ID",
      "xref": "6808"
    },
    {
      "xref_type": "INN_ID",
      "xref": "2897"
    },
    {
      "xref_type": "UNII",
      "xref": "7QID3E7BG7"
    },
    {
      "xref_type": "RXNORM",
      "xref": "1598"
    },
    {
      "xref_type": "MMSL",
      "xref": "1065"
    },
    {
      "xref_type": "MMSL",
      "xref": "4586"
    },
    {
      "xref_type": "MMSL",
      "xref": "d03889"
    },
    {
      "xref_type": "NDDF",
      "xref": "002082"
    },
    {
      "xref_type": "SNOMEDCT_US",
      "xref": "423414002"
    },
    {
      "xref_type": "SNOMEDCT_US",
      "xref": "79209008"
    }
  ],
  "synonyms": [
    "dicoumal",
    "dicoumarin",
    "dicoumarol",
    "dicuman",
    "dicumarine",
    "dicumarol"
  ],
  "atcs": [
    {
      "atc_code": "A10BD09",
      "atc_l1_code": "A",
      "atc_l1_name": "ALIMENTARY TRACT AND METABOLISM",
      "atc_l2_code": "A10",
      "atc_l2_name": "DRUGS USED IN DIABETES",
      "atc_l3_code": "A10B",
      "atc_l3_name": "BLOOD GLUCOSE LOWERING DRUGS, EXCL. INSULINS",
      "atc_l4_code": "A10BD",
      "atc_l4_name": "Combinations of oral blood glucose lowering drugs",
      "atc_substance": "pioglitazone and alogliptin"
    }
  ],
  "targets": [
    {
      "target_id": 268,
      "target_name": "Cytochrome P450 2C9",
      "gene": "CYP2C9",
      "action_type": null,
      "act_source": "WOMBAT-PK",
      "act_type": "Ki",
      "act_comment": null,
      "relation": "=",
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 298,
      "target_name": "Vitamin K epoxide reductase complex subunit 1",
      "gene": "VKORC1",
      "action_type": "INHIBITOR",
      "act_source": "SCIENTIFIC LITERATURE",
      "act_type": "IC50",
      "act_comment": null,
      "relation": "=",
      "moa": 1.0,
      "moa_source": "CHEMBL",
      "moa_source_url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1466",
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 311,
      "target_name": "NAD(P)H dehydrogenase [quinone] 1",
      "gene": "NQO1",
      "action_type": null,
      "act_source": "WOMBAT-PK",
      "act_type": "Ki",
      "act_comment": null,
      "relation": "=",
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 1707,
      "target_name": "Aldose reductase",
      "gene": "Akr1b1",
      "action_type": null,
      "act_source": "DRUG MATRIX",
      "act_type": "IC50",
      "act_comment": "DRUGMATRIX: Aldose Reductase enzyme inhibition (substrate: DL-Glyceraldehyde)",
      "relation": "=",
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 1712,
      "target_name": "Mitogen-activated protein kinase 1",
      "gene": "MAPK1",
      "action_type": null,
      "act_source": "DRUG MATRIX",
      "act_type": "IC50",
      "act_comment": "DRUGMATRIX: Protein Serine/Threonine Kinase, ERK2 enzyme inhibition (substrate: Myelin Basic Protein)",
      "relation": "=",
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 2438,
      "target_name": "Proprotein convertase subtilisin/kexin type 7",
      "gene": "PCSK7",
      "action_type": null,
      "act_source": "CHEMBL",
      "act_type": "IC50",
      "act_comment": "Inhibition of recombinant type 8 subtilisin using Arg-Glu-(EDANS)- Ser-Gln-Asn-Tyr-Pro-Ile-Val-Gln-Lys-(DALBCYL)-Arg fluorogenic substrate preincubated for 1 hr measured after 1 hr at 1 min interval by fluorescence assay",
      "relation": "=",
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 2478,
      "target_name": "G-protein coupled receptor 35",
      "gene": "GPR35",
      "action_type": null,
      "act_source": "CHEMBL",
      "act_type": "Ki",
      "act_comment": "Displacement of [3H]PSB-13253 from human recombinant GPR35 exprssed in CHO cells by liquid scintillation counting analysis",
      "relation": "=",
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 2566,
      "target_name": "Enoyl-[acyl-carrier-protein] reductase [NADH]",
      "gene": "fabI",
      "action_type": null,
      "act_source": "CHEMBL",
      "act_type": "IC50",
      "act_comment": "Inhibition of C-terminal His6-tagged Francisella tularensis SCHU S4 FabI expressed in Escherichia coli BL21 (DE3) using CrCoA as substrate assessed as oxidation of NADH to NAD+ by fluorescence assay",
      "relation": "=",
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 3413,
      "target_name": "Urease",
      "gene": null,
      "action_type": null,
      "act_source": "CHEMBL",
      "act_type": "IC50",
      "act_comment": "Inhibition of jack bean urease",
      "relation": "=",
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    },
    {
      "target_id": 3594,
      "target_name": "ATP phosphoribosyltransferase",
      "gene": "hisG",
      "action_type": null,
      "act_source": "CHEMBL",
      "act_type": "Ki",
      "act_comment": "Inhibition of Mycobacterium tuberculosis HisG assessed as phosphoribosyl ATP production by spectrophotometry",
      "relation": "=",
      "moa": NaN,
      "moa_source": null,
      "moa_source_url": null,
      "ref_pmid": null,
      "ref_doi": null,
      "ref_title": null,
      "ref_year": null
    }
  ],
  "indications": [
    {
      "omop_concept_id": 21001622,
      "omop_concept_name": "Prevention of Cerebral Thrombosis",
      "umls_cui": null,
      "umls_semantic_type": null,
      "snomed_conceptid": NaN,
      "snomed_full_name": null
    },
    {
      "omop_concept_id": 21001447,
      "omop_concept_name": "Myocardial infarction",
      "umls_cui": "C0027051",
      "umls_semantic_type": "T047",
      "snomed_conceptid": 22298006.0,
      "snomed_full_name": "Myocardial infarction"
    },
    {
      "omop_concept_id": 21001655,
      "omop_concept_name": "Thromboembolic disorder",
      "umls_cui": "C0040038",
      "umls_semantic_type": "T047",
      "snomed_conceptid": 371039008.0,
      "snomed_full_name": "Thromboembolic disorder"
    },
    {
      "omop_concept_id": 21001685,
      "omop_concept_name": "Thrombosis",
      "umls_cui": "C0040053",
      "umls_semantic_type": "T046",
      "snomed_conceptid": 439127006.0,
      "snomed_full_name": "Thrombosis"
    },
    {
      "omop_concept_id": 21001626,
      "omop_concept_name": "Cerebral embolism",
      "umls_cui": "C0007780",
      "umls_semantic_type": "T047",
      "snomed_conceptid": 75543006.0,
      "snomed_full_name": "Cerebral embolism"
    }
  ]
}